C17H40N4 — CID 153341749
1-N-[4-[3-(butan-2-ylamino)butylamino]butyl]-3-N-methylbutane-1,3-diamine (PubChem CID 153341749) has the molecular formula C17H40N4 and a molecular weight of 300.53 g/mol. Its IUPAC name is 1-N-[4-[3-(butan-2-ylamino)butylamino]butyl]-3-N-methylbutane-1,3-diamine.
| Compound Name | 1-N-[4-[3-(butan-2-ylamino)butylamino]butyl]-3-N-methylbutane-1,3-diamine |
|---|---|
| PubChem CID | 153341749 |
| Molecular Formula | C17H40N4 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.33 |
| IUPAC Name | 1-N-[4-[3-(butan-2-ylamino)butylamino]butyl]-3-N-methylbutane-1,3-diamine |
| SMILES | CCC(C)NC(C)CCNCCCCNCCC(C)NC |
| InChI | InChI=1S/C17H40N4/c1-6-15(2)21-17(4)10-14-20-12-8-7-11-19-13-9-16(3)18-5/h15-21H,6-14H2,1-5H3 |
| InChIKey | KCFOQZPLKPMBNO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|