C9H22N2 — CID 166714486
(5R)-1-N-ethyl-5-N-methylhexane-1,5-diamine (PubChem CID 166714486) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is (5R)-1-N-ethyl-5-N-methylhexane-1,5-diamine.
| Compound Name | (5R)-1-N-ethyl-5-N-methylhexane-1,5-diamine |
|---|---|
| PubChem CID | 166714486 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | (5R)-1-N-ethyl-5-N-methylhexane-1,5-diamine |
| SMILES | CCNCCCC[C@@H](C)NC |
| InChI | InChI=1S/C9H22N2/c1-4-11-8-6-5-7-9(2)10-3/h9-11H,4-8H2,1-3H3/t9-/m1/s1 |
| InChIKey | RWHFHVFESZPXOU-SECBINFHSA-N |
| XLogP | 1.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|