C11H28N2O3Si — CID 172810414
3-N-methyl-1-N-(3-trimethoxysilylpropyl)butane-1,3-diamine (PubChem CID 172810414) has the molecular formula C11H28N2O3Si and a molecular weight of 264.44 g/mol. Its IUPAC name is 3-N-methyl-1-N-(3-trimethoxysilylpropyl)butane-1,3-diamine.
| Compound Name | 3-N-methyl-1-N-(3-trimethoxysilylpropyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 172810414 |
| Molecular Formula | C11H28N2O3Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 3-N-methyl-1-N-(3-trimethoxysilylpropyl)butane-1,3-diamine |
| SMILES | CNC(C)CCNCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C11H28N2O3Si/c1-11(12-2)7-9-13-8-6-10-17(14-3,15-4)16-5/h11-13H,6-10H2,1-5H3 |
| InChIKey | SCEBZJDONGNXCZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|