C24H60N4O6Si2 — CID 157123454
N'-(3-trimethoxysilylpropyl)hexane-1,6-diamine (PubChem CID 157123454) has the molecular formula C24H60N4O6Si2 and a molecular weight of 556.94 g/mol. Its IUPAC name is N'-(3-trimethoxysilylpropyl)hexane-1,6-diamine.
| Compound Name | N'-(3-trimethoxysilylpropyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 157123454 |
| Molecular Formula | C24H60N4O6Si2 |
| Molecular Weight | 556.94 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | N'-(3-trimethoxysilylpropyl)hexane-1,6-diamine |
| SMILES | CO[Si](CCCNCCCCCCN)(OC)OC.CO[Si](CCCNCCCCCCN)(OC)OC |
| InChI | InChI=1S/2C12H30N2O3Si/c2*1-15-18(16-2,17-3)12-8-11-14-10-7-5-4-6-9-13/h2*14H,4-13H2,1-3H3 |
| InChIKey | AIFZWVWBWAAQCN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 131.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.94 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|