C10H30N4O3Si — CID 158654505
N'-(2-aminoethyl)ethane-1,2-diamine;3-trimethoxysilylpropan-1-amine (PubChem CID 158654505) has the molecular formula C10H30N4O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;3-trimethoxysilylpropan-1-amine.
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;3-trimethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 158654505 |
| Molecular Formula | C10H30N4O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;3-trimethoxysilylpropan-1-amine |
| SMILES | CO[Si](CCCN)(OC)OC.NCCNCCN |
| InChI | InChI=1S/C6H17NO3Si.C4H13N3/c1-8-11(9-2,10-3)6-4-5-7;5-1-3-7-4-2-6/h4-7H2,1-3H3;7H,1-6H2 |
| InChIKey | IBYRXBNZKXINHG-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|