About cyclobutane;3-trimethoxysilylpropan-1-amine
cyclobutane;3-trimethoxysilylpropan-1-amine (PubChem CID 175187694) has the molecular formula C10H25NO3Si
and a molecular weight of 235.40 g/mol. Its IUPAC name is cyclobutane;3-trimethoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | cyclobutane;3-trimethoxysilylpropan-1-amine |
| PubChem CID | 175187694 |
| Molecular Formula | C10H25NO3Si |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | cyclobutane;3-trimethoxysilylpropan-1-amine |
| SMILES | C1CCC1.CO[Si](CCCN)(OC)OC |
| InChI | InChI=1S/C6H17NO3Si.C4H8/c1-8-11(9-2,10-3)6-4-5-7;1-2-4-3-1/h4-7H2,1-3H3;1-4H2 |
| InChIKey | JPDJRDHSHYFKIR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclobutane;3-trimethoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane;3-trimethoxysilylpropan-1-amine?
The IUPAC name of cyclobutane;3-trimethoxysilylpropan-1-amine (CID 175187694) is cyclobutane;3-trimethoxysilylpropan-1-amine.
What is the SMILES notation for cyclobutane;3-trimethoxysilylpropan-1-amine?
The canonical SMILES for cyclobutane;3-trimethoxysilylpropan-1-amine is C1CCC1.CO[Si](CCCN)(OC)OC.
What is the InChIKey of cyclobutane;3-trimethoxysilylpropan-1-amine?
The InChIKey is JPDJRDHSHYFKIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17NO3Si.C4H8/c1-8-11(9-2,10-3)6-4-5-7;1-2-4-3-1/h4-7H2,1-3H3;1-4H2.
What are the key properties of cyclobutane;3-trimethoxysilylpropan-1-amine?
cyclobutane;3-trimethoxysilylpropan-1-amine has a molecular weight of 235.40 g/mol, XLogP of 1.77, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane;3-trimethoxysilylpropan-1-amine is sourced from PubChem (CID 175187694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).