About 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine
3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine (PubChem CID 158758636) has the molecular formula C9H28N2O3Si2
and a molecular weight of 268.51 g/mol. Its IUPAC name is 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine |
| PubChem CID | 158758636 |
| Molecular Formula | C9H28N2O3Si2 |
| Molecular Weight | 268.51 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine |
| SMILES | CO[Si](CCCN)(OC)OC.NCCC[SiH3] |
| InChI | InChI=1S/C6H17NO3Si.C3H11NSi/c1-8-11(9-2,10-3)6-4-5-7;4-2-1-3-5/h4-7H2,1-3H3;1-4H2,5H3 |
| InChIKey | IOJSCWLZUZCFNS-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.51 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine?
The IUPAC name of 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine (CID 158758636) is 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine.
What is the SMILES notation for 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine?
The canonical SMILES for 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine is CO[Si](CCCN)(OC)OC.NCCC[SiH3].
What is the InChIKey of 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine?
The InChIKey is IOJSCWLZUZCFNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17NO3Si.C3H11NSi/c1-8-11(9-2,10-3)6-4-5-7;4-2-1-3-5/h4-7H2,1-3H3;1-4H2,5H3.
What are the key properties of 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine?
3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine has a molecular weight of 268.51 g/mol, XLogP of -0.67, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-silylpropan-1-amine;3-trimethoxysilylpropan-1-amine is sourced from PubChem (CID 158758636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).