C14H38N2O6Si2 — CID 87575509
N,N-dimethyl-3-trimethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine (PubChem CID 87575509) has the molecular formula C14H38N2O6Si2 and a molecular weight of 386.64 g/mol. Its IUPAC name is N,N-dimethyl-3-trimethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine.
| Compound Name | N,N-dimethyl-3-trimethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 87575509 |
| Molecular Formula | C14H38N2O6Si2 |
| Molecular Weight | 386.64 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N,N-dimethyl-3-trimethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine |
| SMILES | CO[Si](CCCN(C)C)(OC)OC.CO[Si](CCCN)(OC)OC |
| InChI | InChI=1S/C8H21NO3Si.C6H17NO3Si/c1-9(2)7-6-8-13(10-3,11-4)12-5;1-8-11(9-2,10-3)6-4-5-7/h6-8H2,1-5H3;4-7H2,1-3H3 |
| InChIKey | AUTADCNENZXBEO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.64 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|