C8H24N3O5Si+ — CID 174780413
amino-hydroxy-oxoazanium;N,N-dimethyl-3-trimethoxysilylpropan-1-amine (PubChem CID 174780413) has the molecular formula C8H24N3O5Si+ and a molecular weight of 270.38 g/mol. Its IUPAC name is amino-hydroxy-oxoazanium;N,N-dimethyl-3-trimethoxysilylpropan-1-amine.
| Compound Name | amino-hydroxy-oxoazanium;N,N-dimethyl-3-trimethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 174780413 |
| Molecular Formula | C8H24N3O5Si+ |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | amino-hydroxy-oxoazanium;N,N-dimethyl-3-trimethoxysilylpropan-1-amine |
| SMILES | CO[Si](CCCN(C)C)(OC)OC.N[N+](=O)O |
| InChI | InChI=1S/C8H21NO3Si.H3N2O2/c1-9(2)7-6-8-13(10-3,11-4)12-5;1-2(3)4/h6-8H2,1-5H3;1H2,(H,3,4)/q;+1 |
| InChIKey | HODOSMXDSQQLBQ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|