C14H32BrNO7Si2 — CID 168863060
2-bromo-N,N-bis(3-trimethoxysilylpropyl)acetamide (PubChem CID 168863060) has the molecular formula C14H32BrNO7Si2 and a molecular weight of 462.49 g/mol. Its IUPAC name is 2-bromo-N,N-bis(3-trimethoxysilylpropyl)acetamide.
| Compound Name | 2-bromo-N,N-bis(3-trimethoxysilylpropyl)acetamide |
|---|---|
| PubChem CID | 168863060 |
| Molecular Formula | C14H32BrNO7Si2 |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 2-bromo-N,N-bis(3-trimethoxysilylpropyl)acetamide |
| SMILES | CO[Si](CCCN(CCC[Si](OC)(OC)OC)C(=O)CBr)(OC)OC |
| InChI | InChI=1S/C14H32BrNO7Si2/c1-18-24(19-2,20-3)11-7-9-16(14(17)13-15)10-8-12-25(21-4,22-5)23-6/h7-13H2,1-6H3 |
| InChIKey | KUQZIJOXZLHJTB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|