C15H35NO8Si2 — CID 140720922
2-hydroxy-N,N-bis(3-trimethoxysilylpropyl)propanamide (PubChem CID 140720922) has the molecular formula C15H35NO8Si2 and a molecular weight of 413.62 g/mol. Its IUPAC name is 2-hydroxy-N,N-bis(3-trimethoxysilylpropyl)propanamide.
| Compound Name | 2-hydroxy-N,N-bis(3-trimethoxysilylpropyl)propanamide |
|---|---|
| PubChem CID | 140720922 |
| Molecular Formula | C15H35NO8Si2 |
| Molecular Weight | 413.62 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-hydroxy-N,N-bis(3-trimethoxysilylpropyl)propanamide |
| SMILES | CO[Si](CCCN(CCC[Si](OC)(OC)OC)C(=O)C(C)O)(OC)OC |
| InChI | InChI=1S/C15H35NO8Si2/c1-14(17)15(18)16(10-8-12-25(19-2,20-3)21-4)11-9-13-26(22-5,23-6)24-7/h14,17H,8-13H2,1-7H3 |
| InChIKey | OEVQKPSNPSBGRC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.62 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|