About 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate
2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate (PubChem CID 123202307) has the molecular formula C14H25NO8
and a molecular weight of 335.35 g/mol. Its IUPAC name is 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate |
| PubChem CID | 123202307 |
| Molecular Formula | C14H25NO8 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate |
| SMILES | COC(C)C(=O)OCCN(CCOC(=O)C(C)O)C(=O)C(C)O |
| InChI | InChI=1S/C14H25NO8/c1-9(16)12(18)15(5-7-22-13(19)10(2)17)6-8-23-14(20)11(3)21-4/h9-11,16-17H,5-8H2,1-4H3 |
| InChIKey | UEGYYYJDEXFQNW-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate?
The IUPAC name of 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate (CID 123202307) is 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate.
What is the SMILES notation for 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate?
The canonical SMILES for 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate is COC(C)C(=O)OCCN(CCOC(=O)C(C)O)C(=O)C(C)O.
What is the InChIKey of 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate?
The InChIKey is UEGYYYJDEXFQNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO8/c1-9(16)12(18)15(5-7-22-13(19)10(2)17)6-8-23-14(20)11(3)21-4/h9-11,16-17H,5-8H2,1-4H3.
What are the key properties of 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate?
2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate has a molecular weight of 335.35 g/mol, XLogP of -1.30, 10 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-hydroxypropanoyl-[2-(2-methoxypropanoyloxy)ethyl]amino]ethyl 2-hydroxypropanoate is sourced from PubChem (CID 123202307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).