About methyl 2-hydroxypropanoate;hydrochloride
methyl 2-hydroxypropanoate;hydrochloride (PubChem CID 87417627) has the molecular formula C4H9ClO3
and a molecular weight of 140.57 g/mol. Its IUPAC name is methyl 2-hydroxypropanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-hydroxypropanoate;hydrochloride |
| PubChem CID | 87417627 |
| Molecular Formula | C4H9ClO3 |
| Molecular Weight | 140.57 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | methyl 2-hydroxypropanoate;hydrochloride |
| SMILES | COC(=O)C(C)O.Cl |
| InChI | InChI=1S/C4H8O3.ClH/c1-3(5)4(6)7-2;/h3,5H,1-2H3;1H |
| InChIKey | MRBFOPSPCKEESI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.57 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-hydroxypropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxypropanoate;hydrochloride?
The IUPAC name of methyl 2-hydroxypropanoate;hydrochloride (CID 87417627) is methyl 2-hydroxypropanoate;hydrochloride.
What is the SMILES notation for methyl 2-hydroxypropanoate;hydrochloride?
The canonical SMILES for methyl 2-hydroxypropanoate;hydrochloride is COC(=O)C(C)O.Cl.
What is the InChIKey of methyl 2-hydroxypropanoate;hydrochloride?
The InChIKey is MRBFOPSPCKEESI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.ClH/c1-3(5)4(6)7-2;/h3,5H,1-2H3;1H.
What are the key properties of methyl 2-hydroxypropanoate;hydrochloride?
methyl 2-hydroxypropanoate;hydrochloride has a molecular weight of 140.57 g/mol, XLogP of -0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxypropanoate;hydrochloride is sourced from PubChem (CID 87417627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).