About methanol;methyl 2-hydroxypropanoate
methanol;methyl 2-hydroxypropanoate (PubChem CID 157321309) has the molecular formula C5H12O4
and a molecular weight of 136.15 g/mol. Its IUPAC name is methanol;methyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | methanol;methyl 2-hydroxypropanoate |
| PubChem CID | 157321309 |
| Molecular Formula | C5H12O4 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | methanol;methyl 2-hydroxypropanoate |
| SMILES | CO.COC(=O)C(C)O |
| InChI | InChI=1S/C4H8O3.CH4O/c1-3(5)4(6)7-2;1-2/h3,5H,1-2H3;2H,1H3 |
| InChIKey | BEEUFYNMTUYPDZ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanol;methyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;methyl 2-hydroxypropanoate?
The IUPAC name of methanol;methyl 2-hydroxypropanoate (CID 157321309) is methanol;methyl 2-hydroxypropanoate.
What is the SMILES notation for methanol;methyl 2-hydroxypropanoate?
The canonical SMILES for methanol;methyl 2-hydroxypropanoate is CO.COC(=O)C(C)O.
What is the InChIKey of methanol;methyl 2-hydroxypropanoate?
The InChIKey is BEEUFYNMTUYPDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.CH4O/c1-3(5)4(6)7-2;1-2/h3,5H,1-2H3;2H,1H3.
What are the key properties of methanol;methyl 2-hydroxypropanoate?
methanol;methyl 2-hydroxypropanoate has a molecular weight of 136.15 g/mol, XLogP of -0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;methyl 2-hydroxypropanoate is sourced from PubChem (CID 157321309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).