About methyl 2-chloropropanoate;stannane
methyl 2-chloropropanoate;stannane (PubChem CID 173428193) has the molecular formula C4H11ClO2Sn
and a molecular weight of 245.29 g/mol. Its IUPAC name is methyl 2-chloropropanoate;stannane.
Molecular Properties
| Compound Name | methyl 2-chloropropanoate;stannane |
| PubChem CID | 173428193 |
| Molecular Formula | C4H11ClO2Sn |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | methyl 2-chloropropanoate;stannane |
| SMILES | COC(=O)C(C)Cl.[SnH4] |
| InChI | InChI=1S/C4H7ClO2.Sn.4H/c1-3(5)4(6)7-2;;;;;/h3H,1-2H3;;;;; |
| InChIKey | KEDHIEHAKNQOGJ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-chloropropanoate;stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-chloropropanoate;stannane?
The IUPAC name of methyl 2-chloropropanoate;stannane (CID 173428193) is methyl 2-chloropropanoate;stannane.
What is the SMILES notation for methyl 2-chloropropanoate;stannane?
The canonical SMILES for methyl 2-chloropropanoate;stannane is COC(=O)C(C)Cl.[SnH4].
What is the InChIKey of methyl 2-chloropropanoate;stannane?
The InChIKey is KEDHIEHAKNQOGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClO2.Sn.4H/c1-3(5)4(6)7-2;;;;;/h3H,1-2H3;;;;;.
What are the key properties of methyl 2-chloropropanoate;stannane?
methyl 2-chloropropanoate;stannane has a molecular weight of 245.29 g/mol, XLogP of -0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloropropanoate;stannane is sourced from PubChem (CID 173428193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).