About 2-methylsulfanylethyl (2R)-2-hydroxypropanoate
2-methylsulfanylethyl (2R)-2-hydroxypropanoate (PubChem CID 130750231) has the molecular formula C6H12O3S
and a molecular weight of 164.23 g/mol. Its IUPAC name is 2-methylsulfanylethyl (2R)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | 2-methylsulfanylethyl (2R)-2-hydroxypropanoate |
| PubChem CID | 130750231 |
| Molecular Formula | C6H12O3S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 2-methylsulfanylethyl (2R)-2-hydroxypropanoate |
| SMILES | CSCCOC(=O)[C@@H](C)O |
| InChI | InChI=1S/C6H12O3S/c1-5(7)6(8)9-3-4-10-2/h5,7H,3-4H2,1-2H3/t5-/m1/s1 |
| InChIKey | GTZPHMZPOSSKEI-RXMQYKEDSA-N |
| XLogP | 0.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanylethyl (2R)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylethyl (2R)-2-hydroxypropanoate?
The IUPAC name of 2-methylsulfanylethyl (2R)-2-hydroxypropanoate (CID 130750231) is 2-methylsulfanylethyl (2R)-2-hydroxypropanoate.
What is the SMILES notation for 2-methylsulfanylethyl (2R)-2-hydroxypropanoate?
The canonical SMILES for 2-methylsulfanylethyl (2R)-2-hydroxypropanoate is CSCCOC(=O)[C@@H](C)O.
What is the InChIKey of 2-methylsulfanylethyl (2R)-2-hydroxypropanoate?
The InChIKey is GTZPHMZPOSSKEI-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H12O3S/c1-5(7)6(8)9-3-4-10-2/h5,7H,3-4H2,1-2H3/t5-/m1/s1.
What are the key properties of 2-methylsulfanylethyl (2R)-2-hydroxypropanoate?
2-methylsulfanylethyl (2R)-2-hydroxypropanoate has a molecular weight of 164.23 g/mol, XLogP of 0.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylethyl (2R)-2-hydroxypropanoate is sourced from PubChem (CID 130750231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).