C6H9Cl3O3S — CID 174781706
trichloromethyl (2S)-2-hydroxy-4-methylsulfanylbutanoate (PubChem CID 174781706) has the molecular formula C6H9Cl3O3S and a molecular weight of 267.56 g/mol. Its IUPAC name is trichloromethyl (2S)-2-hydroxy-4-methylsulfanylbutanoate.
| Compound Name | trichloromethyl (2S)-2-hydroxy-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 174781706 |
| Molecular Formula | C6H9Cl3O3S |
| Molecular Weight | 267.56 g/mol |
| Exact Mass | 265.93 |
| IUPAC Name | trichloromethyl (2S)-2-hydroxy-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](O)C(=O)OC(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H9Cl3O3S/c1-13-3-2-4(10)5(11)12-6(7,8)9/h4,10H,2-3H2,1H3/t4-/m0/s1 |
| InChIKey | BQIJYSCTYVSEKC-BYPYZUCNSA-N |
| XLogP | 1.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|