C5H10Ni2O3S+4 — CID 46207063
2-hydroxy-4-methylsulfanylbutanoic acid;bis(nickel(2+)) (PubChem CID 46207063) has the molecular formula C5H10Ni2O3S+4 and a molecular weight of 267.58 g/mol. Its IUPAC name is 2-hydroxy-4-methylsulfanylbutanoic acid;bis(nickel(2+)).
| Compound Name | 2-hydroxy-4-methylsulfanylbutanoic acid;bis(nickel(2+)) |
|---|---|
| PubChem CID | 46207063 |
| Molecular Formula | C5H10Ni2O3S+4 |
| Molecular Weight | 267.58 g/mol |
| Exact Mass | 265.90 |
| IUPAC Name | 2-hydroxy-4-methylsulfanylbutanoic acid;bis(nickel(2+)) |
| SMILES | CSCCC(O)C(=O)O.[Ni+2].[Ni+2] |
| InChI | InChI=1S/C5H10O3S.2Ni/c1-9-3-2-4(6)5(7)8;;/h4,6H,2-3H2,1H3,(H,7,8);;/q;2*+2 |
| InChIKey | FSWWNQCCCUVWCE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.58 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |