About bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+)
bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+) (PubChem CID 172761205) has the molecular formula C10H20N2O4PtS2
and a molecular weight of 491.49 g/mol. Its IUPAC name is bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+).
Molecular Properties
| Compound Name | bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+) |
| PubChem CID | 172761205 |
| Molecular Formula | C10H20N2O4PtS2 |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+) |
| SMILES | CSCC[C@H]([NH-])C(=O)O.CSCC[C@H]([NH-])C(=O)O.[Pt+2] |
| InChI | InChI=1S/2C5H10NO2S.Pt/c2*1-9-3-2-4(6)5(7)8;/h2*4,6H,2-3H2,1H3,(H,7,8);/q2*-1;+2/t2*4-;/m00./s1 |
| InChIKey | LSAXIQAFIOZBSY-SCGRZTRASA-N |
| XLogP | 2.49 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+)?
The IUPAC name of bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+) (CID 172761205) is bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+).
What is the SMILES notation for bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+)?
The canonical SMILES for bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+) is CSCC[C@H]([NH-])C(=O)O.CSCC[C@H]([NH-])C(=O)O.[Pt+2].
What is the InChIKey of bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+)?
The InChIKey is LSAXIQAFIOZBSY-SCGRZTRASA-N. The full InChI is InChI=1S/2C5H10NO2S.Pt/c2*1-9-3-2-4(6)5(7)8;/h2*4,6H,2-3H2,1H3,(H,7,8);/q2*-1;+2/t2*4-;/m00./s1.
What are the key properties of bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+)?
bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+) has a molecular weight of 491.49 g/mol, XLogP of 2.49, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis([(1S)-1-carboxy-3-methylsulfanylpropyl]azanide);platinum(2+) is sourced from PubChem (CID 172761205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).