C7H15NO3S — CID 20660327
2-hydroxy-3-(methylamino)-5-methylsulfanylpentanoic acid (PubChem CID 20660327) has the molecular formula C7H15NO3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-hydroxy-3-(methylamino)-5-methylsulfanylpentanoic acid.
| Compound Name | 2-hydroxy-3-(methylamino)-5-methylsulfanylpentanoic acid |
|---|---|
| PubChem CID | 20660327 |
| Molecular Formula | C7H15NO3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | 2-hydroxy-3-(methylamino)-5-methylsulfanylpentanoic acid |
| SMILES | CNC(CCSC)C(O)C(=O)O |
| InChI | InChI=1S/C7H15NO3S/c1-8-5(3-4-12-2)6(9)7(10)11/h5-6,8-9H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | DHHNHHIYGZFKGR-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |