C9H21N3O2S — CID 155137335
(2S)-N-[(2S)-1-amino-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-(methylamino)propanamide (PubChem CID 155137335) has the molecular formula C9H21N3O2S and a molecular weight of 235.35 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-amino-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(2S)-1-amino-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 155137335 |
| Molecular Formula | C9H21N3O2S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (2S)-N-[(2S)-1-amino-1-hydroxy-4-methylsulfanylbutan-2-yl]-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)N[C@@H](CCSC)C(N)O |
| InChI | InChI=1S/C9H21N3O2S/c1-6(11-2)9(14)12-7(8(10)13)4-5-15-3/h6-8,11,13H,4-5,10H2,1-3H3,(H,12,14)/t6-,7-,8?/m0/s1 |
| InChIKey | QGOBQXDUYVTOFN-WPZUCAASSA-N |
| XLogP | -0.89 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|