C7H17BN2O3S — CID 74765781
[(1R)-1-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]ethyl]boronic acid (PubChem CID 74765781) has the molecular formula C7H17BN2O3S and a molecular weight of 220.10 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 74765781 |
| Molecular Formula | C7H17BN2O3S |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | [(1R)-1-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]ethyl]boronic acid |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](C)B(O)O |
| InChI | InChI=1S/C7H17BN2O3S/c1-5(8(12)13)10-7(11)6(9)3-4-14-2/h5-6,12-13H,3-4,9H2,1-2H3,(H,10,11)/t5-,6-/m0/s1 |
| InChIKey | QZJBAYMFPAFUEH-WDSKDSINSA-N |
| XLogP | -1.42 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|