C10H20N2O3S — CID 107565129
(2S)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]pentanoic acid (PubChem CID 107565129) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]pentanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 107565129 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)[C@H](N)CCSC)C(=O)O |
| InChI | InChI=1S/C10H20N2O3S/c1-3-4-8(10(14)15)12-9(13)7(11)5-6-16-2/h7-8H,3-6,11H2,1-2H3,(H,12,13)(H,14,15)/t7-,8+/m1/s1 |
| InChIKey | GXOMRLQUSKFFHC-SFYZADRCSA-N |
| XLogP | 0.44 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |