C11H22N2O3S2 — CID 153320606
(2S)-2-[[(2S)-2-amino-4-ethylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 153320606) has the molecular formula C11H22N2O3S2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-4-ethylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-4-ethylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 153320606 |
| Molecular Formula | C11H22N2O3S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-4-ethylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCSCC[C@H](N)C(=O)N[C@@H](CCSC)C(=O)O |
| InChI | InChI=1S/C11H22N2O3S2/c1-3-18-7-4-8(12)10(14)13-9(11(15)16)5-6-17-2/h8-9H,3-7,12H2,1-2H3,(H,13,14)(H,15,16)/t8-,9-/m0/s1 |
| InChIKey | FOHVGSHYVKWDEE-IUCAKERBSA-N |
| XLogP | 0.78 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|