C10H22N2OS2 — CID 104909088
(2R)-2-amino-4-methylsulfanyl-N-(1-methylsulfanylbutan-2-yl)butanamide (PubChem CID 104909088) has the molecular formula C10H22N2OS2 and a molecular weight of 250.43 g/mol. Its IUPAC name is (2R)-2-amino-4-methylsulfanyl-N-(1-methylsulfanylbutan-2-yl)butanamide.
| Compound Name | (2R)-2-amino-4-methylsulfanyl-N-(1-methylsulfanylbutan-2-yl)butanamide |
|---|---|
| PubChem CID | 104909088 |
| Molecular Formula | C10H22N2OS2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (2R)-2-amino-4-methylsulfanyl-N-(1-methylsulfanylbutan-2-yl)butanamide |
| SMILES | CCC(CSC)NC(=O)[C@H](N)CCSC |
| InChI | InChI=1S/C10H22N2OS2/c1-4-8(7-15-3)12-10(13)9(11)5-6-14-2/h8-9H,4-7,11H2,1-3H3,(H,12,13)/t8?,9-/m1/s1 |
| InChIKey | FNMCGDLXCDHLAY-YGPZHTELSA-N |
| XLogP | 1.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |