C9H19N3OS2 — CID 155137513
(2S)-2-[[(2S)-2-(methylamino)propanethioyl]amino]-4-methylsulfanylbutanamide (PubChem CID 155137513) has the molecular formula C9H19N3OS2 and a molecular weight of 249.40 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(methylamino)propanethioyl]amino]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-[[(2S)-2-(methylamino)propanethioyl]amino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 155137513 |
| Molecular Formula | C9H19N3OS2 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2S)-2-[[(2S)-2-(methylamino)propanethioyl]amino]-4-methylsulfanylbutanamide |
| SMILES | CN[C@@H](C)C(=S)N[C@@H](CCSC)C(N)=O |
| InChI | InChI=1S/C9H19N3OS2/c1-6(11-2)9(14)12-7(8(10)13)4-5-15-3/h6-7,11H,4-5H2,1-3H3,(H2,10,13)(H,12,14)/t6-,7-/m0/s1 |
| InChIKey | GIGXVIJPJLAGQH-BQBZGAKWSA-N |
| XLogP | 0.12 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|