C7H16N2OS2 — CID 23177233
4-methylsulfanyl-2-(2-sulfanylethylamino)butanamide (PubChem CID 23177233) has the molecular formula C7H16N2OS2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 4-methylsulfanyl-2-(2-sulfanylethylamino)butanamide.
| Compound Name | 4-methylsulfanyl-2-(2-sulfanylethylamino)butanamide |
|---|---|
| PubChem CID | 23177233 |
| Molecular Formula | C7H16N2OS2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4-methylsulfanyl-2-(2-sulfanylethylamino)butanamide |
| SMILES | CSCCC(NCCS)C(N)=O |
| InChI | InChI=1S/C7H16N2OS2/c1-12-5-2-6(7(8)10)9-3-4-11/h6,9,11H,2-5H2,1H3,(H2,8,10) |
| InChIKey | GHRLFOAXBXNPBJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|