C8H17NO3S — CID 62541222
2-(2-methoxyethylamino)-4-methylsulfanylbutanoic acid (PubChem CID 62541222) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-4-methylsulfanylbutanoic acid.
| Compound Name | 2-(2-methoxyethylamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 62541222 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-(2-methoxyethylamino)-4-methylsulfanylbutanoic acid |
| SMILES | COCCNC(CCSC)C(=O)O |
| InChI | InChI=1S/C8H17NO3S/c1-12-5-4-9-7(8(10)11)3-6-13-2/h7,9H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | ZJSLGNSLGSAFMG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|