C6H13NO3SZn — CID 174699111
(2S)-2-(hydroxymethylamino)-4-methylsulfanylbutanoic acid;zinc (PubChem CID 174699111) has the molecular formula C6H13NO3SZn and a molecular weight of 244.63 g/mol. Its IUPAC name is (2S)-2-(hydroxymethylamino)-4-methylsulfanylbutanoic acid;zinc.
| Compound Name | (2S)-2-(hydroxymethylamino)-4-methylsulfanylbutanoic acid;zinc |
|---|---|
| PubChem CID | 174699111 |
| Molecular Formula | C6H13NO3SZn |
| Molecular Weight | 244.63 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | (2S)-2-(hydroxymethylamino)-4-methylsulfanylbutanoic acid;zinc |
| SMILES | CSCC[C@H](NCO)C(=O)O.[Zn] |
| InChI | InChI=1S/C6H13NO3S.Zn/c1-11-3-2-5(6(9)10)7-4-8;/h5,7-8H,2-4H2,1H3,(H,9,10);/t5-;/m0./s1 |
| InChIKey | BYGCFWKYGXMGOP-JEDNCBNOSA-N |
| XLogP | -0.27 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.63 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|