C8H14N2O2S — CID 54033241
(2S)-2-(2-cyanoethylamino)-4-methylsulfanylbutanoic acid (PubChem CID 54033241) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is (2S)-2-(2-cyanoethylamino)-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-(2-cyanoethylamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 54033241 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (2S)-2-(2-cyanoethylamino)-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NCCC#N)C(=O)O |
| InChI | InChI=1S/C8H14N2O2S/c1-13-6-3-7(8(11)12)10-5-2-4-9/h7,10H,2-3,5-6H2,1H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | LHCHRAHJOLPBDV-ZETCQYMHSA-N |
| XLogP | 0.70 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|