C11H18N2O4S — CID 175868828
2-[2-[(1S)-1-carboxy-3-methylsulfanylpropyl]hydrazinyl]hex-5-ynoic acid (PubChem CID 175868828) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-[2-[(1S)-1-carboxy-3-methylsulfanylpropyl]hydrazinyl]hex-5-ynoic acid.
| Compound Name | 2-[2-[(1S)-1-carboxy-3-methylsulfanylpropyl]hydrazinyl]hex-5-ynoic acid |
|---|---|
| PubChem CID | 175868828 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-[2-[(1S)-1-carboxy-3-methylsulfanylpropyl]hydrazinyl]hex-5-ynoic acid |
| SMILES | C#CCCC(NN[C@@H](CCSC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18N2O4S/c1-3-4-5-8(10(14)15)12-13-9(11(16)17)6-7-18-2/h1,8-9,12-13H,4-7H2,2H3,(H,14,15)(H,16,17)/t8?,9-/m0/s1 |
| InChIKey | LVSINEYVEWHWPC-GKAPJAKFSA-N |
| XLogP | 0.15 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|