C7H16N2O5S2 — CID 175760492
(2S)-4-methylsulfanyl-2-[2-(2-sulfoethyl)hydrazinyl]butanoic acid (PubChem CID 175760492) has the molecular formula C7H16N2O5S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[2-(2-sulfoethyl)hydrazinyl]butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-[2-(2-sulfoethyl)hydrazinyl]butanoic acid |
|---|---|
| PubChem CID | 175760492 |
| Molecular Formula | C7H16N2O5S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[2-(2-sulfoethyl)hydrazinyl]butanoic acid |
| SMILES | CSCC[C@H](NNCCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C7H16N2O5S2/c1-15-4-2-6(7(10)11)9-8-3-5-16(12,13)14/h6,8-9H,2-5H2,1H3,(H,10,11)(H,12,13,14)/t6-/m0/s1 |
| InChIKey | MPPXKNGUMKJJRE-LURJTMIESA-N |
| XLogP | -0.83 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|