C10H20N2O5S2 — CID 104910172
(2R)-4-methylsulfanyl-2-(3-methylsulfonylpropylcarbamoylamino)butanoic acid (PubChem CID 104910172) has the molecular formula C10H20N2O5S2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-(3-methylsulfonylpropylcarbamoylamino)butanoic acid.
| Compound Name | (2R)-4-methylsulfanyl-2-(3-methylsulfonylpropylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 104910172 |
| Molecular Formula | C10H20N2O5S2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-(3-methylsulfonylpropylcarbamoylamino)butanoic acid |
| SMILES | CSCC[C@@H](NC(=O)NCCCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C10H20N2O5S2/c1-18-6-4-8(9(13)14)12-10(15)11-5-3-7-19(2,16)17/h8H,3-7H2,1-2H3,(H,13,14)(H2,11,12,15)/t8-/m1/s1 |
| InChIKey | BKCOKWCKRXQRIY-MRVPVSSYSA-N |
| XLogP | -0.07 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|