C10H17F3N2O5S — CID 115521231
4-methylsulfonyl-2-(4,4,4-trifluorobutylcarbamoylamino)butanoic acid (PubChem CID 115521231) has the molecular formula C10H17F3N2O5S and a molecular weight of 334.32 g/mol. Its IUPAC name is 4-methylsulfonyl-2-(4,4,4-trifluorobutylcarbamoylamino)butanoic acid.
| Compound Name | 4-methylsulfonyl-2-(4,4,4-trifluorobutylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 115521231 |
| Molecular Formula | C10H17F3N2O5S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 4-methylsulfonyl-2-(4,4,4-trifluorobutylcarbamoylamino)butanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)NCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H17F3N2O5S/c1-21(19,20)6-3-7(8(16)17)15-9(18)14-5-2-4-10(11,12)13/h7H,2-6H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | OSFPUCZTUWEPJC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|