C10H16F3N3O4 — CID 115521247
(2S)-5-amino-5-oxo-2-(4,4,4-trifluorobutylcarbamoylamino)pentanoic acid (PubChem CID 115521247) has the molecular formula C10H16F3N3O4 and a molecular weight of 299.25 g/mol. Its IUPAC name is (2S)-5-amino-5-oxo-2-(4,4,4-trifluorobutylcarbamoylamino)pentanoic acid.
| Compound Name | (2S)-5-amino-5-oxo-2-(4,4,4-trifluorobutylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 115521247 |
| Molecular Formula | C10H16F3N3O4 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (2S)-5-amino-5-oxo-2-(4,4,4-trifluorobutylcarbamoylamino)pentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)NCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H16F3N3O4/c11-10(12,13)4-1-5-15-9(20)16-6(8(18)19)2-3-7(14)17/h6H,1-5H2,(H2,14,17)(H,18,19)(H2,15,16,20)/t6-/m0/s1 |
| InChIKey | WTHBXUXOYULWDL-LURJTMIESA-N |
| XLogP | 0.35 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|