C9H18N4O4 — CID 62273655
(2S)-5-amino-2-(3-aminopropylcarbamoylamino)-5-oxopentanoic acid (PubChem CID 62273655) has the molecular formula C9H18N4O4 and a molecular weight of 246.27 g/mol. Its IUPAC name is (2S)-5-amino-2-(3-aminopropylcarbamoylamino)-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-(3-aminopropylcarbamoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62273655 |
| Molecular Formula | C9H18N4O4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (2S)-5-amino-2-(3-aminopropylcarbamoylamino)-5-oxopentanoic acid |
| SMILES | NCCCNC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H18N4O4/c10-4-1-5-12-9(17)13-6(8(15)16)2-3-7(11)14/h6H,1-5,10H2,(H2,11,14)(H,15,16)(H2,12,13,17)/t6-/m0/s1 |
| InChIKey | GEZWIIBQLFRGSB-LURJTMIESA-N |
| XLogP | -1.65 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|