C13H26N4O4 — CID 107830495
(2R)-5-amino-2-[3-(diethylamino)propylcarbamoylamino]-5-oxopentanoic acid (PubChem CID 107830495) has the molecular formula C13H26N4O4 and a molecular weight of 302.38 g/mol. Its IUPAC name is (2R)-5-amino-2-[3-(diethylamino)propylcarbamoylamino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[3-(diethylamino)propylcarbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107830495 |
| Molecular Formula | C13H26N4O4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2R)-5-amino-2-[3-(diethylamino)propylcarbamoylamino]-5-oxopentanoic acid |
| SMILES | CCN(CC)CCCNC(=O)N[C@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H26N4O4/c1-3-17(4-2)9-5-8-15-13(21)16-10(12(19)20)6-7-11(14)18/h10H,3-9H2,1-2H3,(H2,14,18)(H,19,20)(H2,15,16,21)/t10-/m1/s1 |
| InChIKey | ZEELASNAEUFVBN-SNVBAGLBSA-N |
| XLogP | -0.26 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|