C12H23N3O4 — CID 114006135
(2R)-5-amino-2-(3,3-dimethylbutylcarbamoylamino)-5-oxopentanoic acid (PubChem CID 114006135) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is (2R)-5-amino-2-(3,3-dimethylbutylcarbamoylamino)-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-(3,3-dimethylbutylcarbamoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 114006135 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (2R)-5-amino-2-(3,3-dimethylbutylcarbamoylamino)-5-oxopentanoic acid |
| SMILES | CC(C)(C)CCNC(=O)N[C@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H23N3O4/c1-12(2,3)6-7-14-11(19)15-8(10(17)18)4-5-9(13)16/h8H,4-7H2,1-3H3,(H2,13,16)(H,17,18)(H2,14,15,19)/t8-/m1/s1 |
| InChIKey | MBPUYASEILKNHR-MRVPVSSYSA-N |
| XLogP | 0.44 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |