C12H21F3N2O3 — CID 115521502
4-methyl-2-(5,5,5-trifluoropentylcarbamoylamino)pentanoic acid (PubChem CID 115521502) has the molecular formula C12H21F3N2O3 and a molecular weight of 298.31 g/mol. Its IUPAC name is 4-methyl-2-(5,5,5-trifluoropentylcarbamoylamino)pentanoic acid.
| Compound Name | 4-methyl-2-(5,5,5-trifluoropentylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 115521502 |
| Molecular Formula | C12H21F3N2O3 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-methyl-2-(5,5,5-trifluoropentylcarbamoylamino)pentanoic acid |
| SMILES | CC(C)CC(NC(=O)NCCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H21F3N2O3/c1-8(2)7-9(10(18)19)17-11(20)16-6-4-3-5-12(13,14)15/h8-9H,3-7H2,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | VZGKFKYQLPMXCK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|