C12H24N2O5S — CID 65093772
2-(3-ethylsulfonylpropylcarbamoylamino)-4-methylpentanoic acid (PubChem CID 65093772) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-(3-ethylsulfonylpropylcarbamoylamino)-4-methylpentanoic acid.
| Compound Name | 2-(3-ethylsulfonylpropylcarbamoylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 65093772 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-(3-ethylsulfonylpropylcarbamoylamino)-4-methylpentanoic acid |
| SMILES | CCS(=O)(=O)CCCNC(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H24N2O5S/c1-4-20(18,19)7-5-6-13-12(17)14-10(11(15)16)8-9(2)3/h9-10H,4-8H2,1-3H3,(H,15,16)(H2,13,14,17) |
| InChIKey | RRAFTOZAEFKYHH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|