C10H21N3O3 — CID 62273310
(2S)-2-(3-aminopropylcarbamoylamino)-4-methylpentanoic acid (PubChem CID 62273310) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is (2S)-2-(3-aminopropylcarbamoylamino)-4-methylpentanoic acid.
| Compound Name | (2S)-2-(3-aminopropylcarbamoylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 62273310 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (2S)-2-(3-aminopropylcarbamoylamino)-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)NCCCN)C(=O)O |
| InChI | InChI=1S/C10H21N3O3/c1-7(2)6-8(9(14)15)13-10(16)12-5-3-4-11/h7-8H,3-6,11H2,1-2H3,(H,14,15)(H2,12,13,16)/t8-/m0/s1 |
| InChIKey | BEWQHRQXPDUJBU-QMMMGPOBSA-N |
| XLogP | 0.13 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|