C8H17N3O4 — CID 81085801
2-(3-aminopropylcarbamoylamino)-3-methoxypropanoic acid (PubChem CID 81085801) has the molecular formula C8H17N3O4 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-(3-aminopropylcarbamoylamino)-3-methoxypropanoic acid.
| Compound Name | 2-(3-aminopropylcarbamoylamino)-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81085801 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2-(3-aminopropylcarbamoylamino)-3-methoxypropanoic acid |
| SMILES | COCC(NC(=O)NCCCN)C(=O)O |
| InChI | InChI=1S/C8H17N3O4/c1-15-5-6(7(12)13)11-8(14)10-4-2-3-9/h6H,2-5,9H2,1H3,(H,12,13)(H2,10,11,14) |
| InChIKey | HRQNSFUXNFTXKS-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|