C10H19N3O6 — CID 113405687
3-methoxy-2-[[2-(2-methoxyethylamino)-2-oxoethyl]carbamoylamino]propanoic acid (PubChem CID 113405687) has the molecular formula C10H19N3O6 and a molecular weight of 277.28 g/mol. Its IUPAC name is 3-methoxy-2-[[2-(2-methoxyethylamino)-2-oxoethyl]carbamoylamino]propanoic acid.
| Compound Name | 3-methoxy-2-[[2-(2-methoxyethylamino)-2-oxoethyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 113405687 |
| Molecular Formula | C10H19N3O6 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-methoxy-2-[[2-(2-methoxyethylamino)-2-oxoethyl]carbamoylamino]propanoic acid |
| SMILES | COCCNC(=O)CNC(=O)NC(COC)C(=O)O |
| InChI | InChI=1S/C10H19N3O6/c1-18-4-3-11-8(14)5-12-10(17)13-7(6-19-2)9(15)16/h7H,3-6H2,1-2H3,(H,11,14)(H,15,16)(H2,12,13,17) |
| InChIKey | ZJOIJAHBVKRCCD-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|