C12H23N3O5 — CID 115356685
2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]-4-methoxybutanoic acid (PubChem CID 115356685) has the molecular formula C12H23N3O5 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]-4-methoxybutanoic acid.
| Compound Name | 2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 115356685 |
| Molecular Formula | C12H23N3O5 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)NCC(=O)NC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H23N3O5/c1-12(2,3)15-9(16)7-13-11(19)14-8(10(17)18)5-6-20-4/h8H,5-7H2,1-4H3,(H,15,16)(H,17,18)(H2,13,14,19) |
| InChIKey | SFIITVYIRMGQPS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |