C12H23N3O4S — CID 29042015
(2S)-2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 29042015) has the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. Its IUPAC name is (2S)-2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 29042015 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2S)-2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)NCC(=O)NC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H23N3O4S/c1-12(2,3)15-9(16)7-13-11(19)14-8(10(17)18)5-6-20-4/h8H,5-7H2,1-4H3,(H,15,16)(H,17,18)(H2,13,14,19)/t8-/m0/s1 |
| InChIKey | FOOVSHLCFTZBCO-QMMMGPOBSA-N |
| XLogP | 0.41 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |