C9H16N2O3S — CID 40640546
(2R)-4-methylsulfanyl-2-(prop-2-enylcarbamoylamino)butanoic acid (PubChem CID 40640546) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-(prop-2-enylcarbamoylamino)butanoic acid.
| Compound Name | (2R)-4-methylsulfanyl-2-(prop-2-enylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 40640546 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-(prop-2-enylcarbamoylamino)butanoic acid |
| SMILES | C=CCNC(=O)N[C@H](CCSC)C(=O)O |
| InChI | InChI=1S/C9H16N2O3S/c1-3-5-10-9(14)11-7(8(12)13)4-6-15-2/h3,7H,1,4-6H2,2H3,(H,12,13)(H2,10,11,14)/t7-/m1/s1 |
| InChIKey | AKCFHTHGDUJWFT-SSDOTTSWSA-N |
| XLogP | 0.68 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|