C13H25N3O4S — CID 104910188
(2R)-2-[[3-(butan-2-ylamino)-3-oxopropyl]carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 104910188) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is (2R)-2-[[3-(butan-2-ylamino)-3-oxopropyl]carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[[3-(butan-2-ylamino)-3-oxopropyl]carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104910188 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (2R)-2-[[3-(butan-2-ylamino)-3-oxopropyl]carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CCC(C)NC(=O)CCNC(=O)N[C@H](CCSC)C(=O)O |
| InChI | InChI=1S/C13H25N3O4S/c1-4-9(2)15-11(17)5-7-14-13(20)16-10(12(18)19)6-8-21-3/h9-10H,4-8H2,1-3H3,(H,15,17)(H,18,19)(H2,14,16,20)/t9?,10-/m1/s1 |
| InChIKey | WRMFYIBSUBQTRB-QVDQXJPCSA-N |
| XLogP | 0.80 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |