C9H14N2O7 — CID 61181286
2-[(2-methoxy-2-oxoethyl)carbamoylamino]pentanedioic acid (PubChem CID 61181286) has the molecular formula C9H14N2O7 and a molecular weight of 262.22 g/mol. Its IUPAC name is 2-[(2-methoxy-2-oxoethyl)carbamoylamino]pentanedioic acid.
| Compound Name | 2-[(2-methoxy-2-oxoethyl)carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 61181286 |
| Molecular Formula | C9H14N2O7 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-[(2-methoxy-2-oxoethyl)carbamoylamino]pentanedioic acid |
| SMILES | COC(=O)CNC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14N2O7/c1-18-7(14)4-10-9(17)11-5(8(15)16)2-3-6(12)13/h5H,2-4H2,1H3,(H,12,13)(H,15,16)(H2,10,11,17) |
| InChIKey | FYHSJZZYSJNJEJ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |