C10H16N2O5 — CID 61183186
(2S)-2-(cyclopropylmethylcarbamoylamino)pentanedioic acid (PubChem CID 61183186) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is (2S)-2-(cyclopropylmethylcarbamoylamino)pentanedioic acid.
| Compound Name | (2S)-2-(cyclopropylmethylcarbamoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 61183186 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2S)-2-(cyclopropylmethylcarbamoylamino)pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NCC1CC1)C(=O)O |
| InChI | InChI=1S/C10H16N2O5/c13-8(14)4-3-7(9(15)16)12-10(17)11-5-6-1-2-6/h6-7H,1-5H2,(H,13,14)(H,15,16)(H2,11,12,17)/t7-/m0/s1 |
| InChIKey | KKGOGMXYVGBWTE-ZETCQYMHSA-N |
| XLogP | 0.01 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |