C12H19N3O6 — CID 104865051
(2S)-2-[2-(cyclopropanecarbonylamino)ethylcarbamoylamino]pentanedioic acid (PubChem CID 104865051) has the molecular formula C12H19N3O6 and a molecular weight of 301.30 g/mol. Its IUPAC name is (2S)-2-[2-(cyclopropanecarbonylamino)ethylcarbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[2-(cyclopropanecarbonylamino)ethylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 104865051 |
| Molecular Formula | C12H19N3O6 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (2S)-2-[2-(cyclopropanecarbonylamino)ethylcarbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NCCNC(=O)C1CC1)C(=O)O |
| InChI | InChI=1S/C12H19N3O6/c16-9(17)4-3-8(11(19)20)15-12(21)14-6-5-13-10(18)7-1-2-7/h7-8H,1-6H2,(H,13,18)(H,16,17)(H,19,20)(H2,14,15,21)/t8-/m0/s1 |
| InChIKey | DHLQWBNRKAAHSB-QMMMGPOBSA-N |
| XLogP | -0.87 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|